![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| AFS Group Structure and Ownership Hierarchy.html | 2008-10-15 18:22 | 13K | |
| Access and Passwords.html | 2008-10-15 18:22 | 3.9K | |
| Batch Submission.html | 2008-10-15 18:22 | 2.3K | |
| CAS.html | 2008-10-15 18:22 | 1.3K | |
| Confluence.html | 2008-10-15 18:23 | 1.3K | |
| Confluence Upgrade.html | 2008-10-15 18:22 | 4.3K | |
| Confuence and Jira Upgrade instructions.html | 2008-10-15 18:23 | 4.0K | |
| Cruise Control.html | 2008-10-15 18:23 | 2.5K | |
| Cruise Control Instructions.html | 2008-10-15 18:23 | 2.6K | |
| Cygwin.html | 2008-10-15 18:23 | 5.6K | |
| Failure Symptoms.html | 2008-10-15 18:23 | 3.9K | |
| FastCopy.html | 2008-10-15 18:23 | 1.8K | |
| HTF Confluence.html | 2008-10-15 18:23 | 7.9K | |
| HTF Data Catalog.html | 2008-10-15 18:23 | 2.5K | |
| HTF Data Catalog Crawler.html | 2008-10-15 18:23 | 4.5K | |
| HTF FC Incoming.html | 2008-10-15 18:23 | 7.1K | |
| HTF FC Outgoing.html | 2008-10-15 18:23 | 13K | |
| HTF Halfpipe.html | 2008-10-15 18:23 | 3.5K | |
| HTF LogWatcher.html | 2008-10-15 18:23 | 1.4K | |
| HTF MySQL.html | 2008-10-15 18:23 | 3.2K | |
| HTF Oracle.html | 2008-10-15 18:23 | 2.6K | |
| HTF Pipeline II.html | 2008-10-15 18:23 | 6.9K | |
| HTF Tomcat Servers.html | 2008-10-15 18:23 | 14K | |
| HTF Xrootd.html | 2008-10-15 18:23 | 6.4K | |
| HTF mocTicker.html | 2008-10-15 18:23 | 5.0K | |
| How to Fix - Home.html | 2009-06-16 18:54 | 16K | |
| How to change Oracle passwords.html | 2008-10-15 18:23 | 4.3K | |
| IIS.html | 2008-10-15 18:23 | 1.3K | |
| Index.html | 2008-10-15 18:23 | 38K | |
| JIRA.html | 2008-10-15 18:23 | 1.3K | |
| Legacy Home.html | 2008-10-15 18:23 | 14K | |
| Linux Servers.html | 2008-10-15 18:23 | 1.3K | |
| LogWatcher.html | 2008-10-15 18:23 | 2.2K | |
| NFS and Xroot Disk Allocations.html | 2008-10-15 18:23 | 30K | |
| Obsolete stuff.html | 2008-10-15 18:23 | 1.3K | |
| Oracler Servers.html | 2008-10-15 18:23 | 1.2K | |
| Pipeline.html | 2008-10-15 18:23 | 2.3K | |
| Pipeline XML Configuration Uploaders.html | 2008-10-15 18:23 | 9.8K | |
| Recovering from Oralce Data Loss.html | 2008-10-15 18:23 | 21K | |
| Release Manager - Batch Jobs.html | 2008-10-15 18:23 | 2.3K | |
| Release Manager.html | 2008-10-15 18:23 | 4.6K | |
| SAS Resources by Monitoring Tool.html | 2008-10-15 18:23 | 6.3K | |
| Servers and Aliases.html | 2008-10-15 18:23 | 20K | |
| System Tests web front-end.html | 2008-10-15 18:23 | 3.2K | |
| Tomcat.html | 2008-10-15 18:23 | 5.4K | |
| Tomcat Connector.html | 2008-10-15 18:23 | 7.7K | |
| Web Applications.html | 2008-10-15 18:23 | 1.4K | |
| Windows Servers.html | 2008-10-15 18:23 | 1.3K | |
| _notes/ | 2012-05-09 10:16 | - | |
| border/ | 2012-05-09 10:16 | - | |
| crontab.html | 2008-10-15 18:23 | 2.4K | |
| glast05.html | 2008-10-15 18:23 | 1.3K | |
| glast06.html | 2008-10-15 18:23 | 8.9K | |
| glast09.html | 2008-10-15 18:23 | 1.7K | |
| icons/ | 2012-05-09 10:16 | - | |
| styles/ | 2012-05-09 10:16 | - | |
| using rsync to backup nfs partitions.html | 2008-10-15 18:23 | 2.7K | |
| web007.html | 2008-10-15 18:23 | 5.0K | |
| xrootd.html | 2008-10-15 18:23 | 5.2K | |